C25H36N6O3 — CID 143411031
4-(cyclohexylmethyl)-6-[(E,4Z)-4-hydroxyiminopent-2-en-3-yl]-2-(2-morpholin-4-ylethylamino)pyrido[2,3-b]pyrazin-3-one (PubChem CID 143411031) has the molecular formula C25H36N6O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-6-[(E,4Z)-4-hydroxyiminopent-2-en-3-yl]-2-(2-morpholin-4-ylethylamino)pyrido[2,3-b]pyrazin-3-one.
| Compound Name | 4-(cyclohexylmethyl)-6-[(E,4Z)-4-hydroxyiminopent-2-en-3-yl]-2-(2-morpholin-4-ylethylamino)pyrido[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 143411031 |
| Molecular Formula | C25H36N6O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | 4-(cyclohexylmethyl)-6-[(E,4Z)-4-hydroxyiminopent-2-en-3-yl]-2-(2-morpholin-4-ylethylamino)pyrido[2,3-b]pyrazin-3-one |
| SMILES | C/C=C(C(/C)=N\O)\c1ccc2nc(NCCN3CCOCC3)c(=O)n(CC3CCCCC3)c2n1 |
| InChI | InChI=1S/C25H36N6O3/c1-3-20(18(2)29-33)21-9-10-22-24(28-21)31(17-19-7-5-4-6-8-19)25(32)23(27-22)26-11-12-30-13-15-34-16-14-30/h3,9-10,19,33H,4-8,11-17H2,1-2H3,(H,26,27)/b20-3-,29-18- |
| InChIKey | YNUUJIIDAZCKCJ-OWUWBSCTSA-N |
| XLogP | 3.37 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|