C13H13NS — CID 143411145
2,3-bis(ethenyl)-4,8-dihydrocyclohepta[b][1,4]thiazine (PubChem CID 143411145) has the molecular formula C13H13NS and a molecular weight of 215.32 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4,8-dihydrocyclohepta[b][1,4]thiazine.
| Compound Name | 2,3-bis(ethenyl)-4,8-dihydrocyclohepta[b][1,4]thiazine |
|---|---|
| PubChem CID | 143411145 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2,3-bis(ethenyl)-4,8-dihydrocyclohepta[b][1,4]thiazine |
| SMILES | C=CC1=C(C=C)SC2=CCC=CC=C2N1 |
| InChI | InChI=1S/C13H13NS/c1-3-10-12(4-2)15-13-9-7-5-6-8-11(13)14-10/h3-6,8-9,14H,1-2,7H2 |
| InChIKey | DPKVGDNFNYURRA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |