C21H20ClN5 — CID 143411570
3-[6-[2-(5-chloro-2-methylphenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile (PubChem CID 143411570) has the molecular formula C21H20ClN5 and a molecular weight of 377.88 g/mol. Its IUPAC name is 3-[6-[2-(5-chloro-2-methylphenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[6-[2-(5-chloro-2-methylphenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 143411570 |
| Molecular Formula | C21H20ClN5 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 3-[6-[2-(5-chloro-2-methylphenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile |
| SMILES | Cc1ccc(Cl)cc1C#CC1CCC2CN(c3nccnc3C#N)CCN12 |
| InChI | InChI=1S/C21H20ClN5/c1-15-2-4-17(22)12-16(15)3-5-18-6-7-19-14-26(10-11-27(18)19)21-20(13-23)24-8-9-25-21/h2,4,8-9,12,18-19H,6-7,10-11,14H2,1H3 |
| InChIKey | FTYGCBITBNYDBU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|