C20H20N4O2S — CID 143412206
3-(3-ethylbenzimidazol-5-yl)-4-(5-ethyl-2,4-dihydroxyphenyl)-1H-imidazole-2-thione (PubChem CID 143412206) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 3-(3-ethylbenzimidazol-5-yl)-4-(5-ethyl-2,4-dihydroxyphenyl)-1H-imidazole-2-thione.
| Compound Name | 3-(3-ethylbenzimidazol-5-yl)-4-(5-ethyl-2,4-dihydroxyphenyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 143412206 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3-(3-ethylbenzimidazol-5-yl)-4-(5-ethyl-2,4-dihydroxyphenyl)-1H-imidazole-2-thione |
| SMILES | CCc1cc(-c2c[nH]c(=S)n2-c2ccc3ncn(CC)c3c2)c(O)cc1O |
| InChI | InChI=1S/C20H20N4O2S/c1-3-12-7-14(19(26)9-18(12)25)17-10-21-20(27)24(17)13-5-6-15-16(8-13)23(4-2)11-22-15/h5-11,25-26H,3-4H2,1-2H3,(H,21,27) |
| InChIKey | HXGRNFMYEROCQO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|