C24H24N4O2S — CID 143412211
4-(5-ethyl-2-hydroxy-4-nitrosophenyl)-3-(9-methyl-5,6,7,8-tetrahydrocarbazol-3-yl)-1H-imidazole-2-thione (PubChem CID 143412211) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 4-(5-ethyl-2-hydroxy-4-nitrosophenyl)-3-(9-methyl-5,6,7,8-tetrahydrocarbazol-3-yl)-1H-imidazole-2-thione.
| Compound Name | 4-(5-ethyl-2-hydroxy-4-nitrosophenyl)-3-(9-methyl-5,6,7,8-tetrahydrocarbazol-3-yl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 143412211 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 4-(5-ethyl-2-hydroxy-4-nitrosophenyl)-3-(9-methyl-5,6,7,8-tetrahydrocarbazol-3-yl)-1H-imidazole-2-thione |
| SMILES | CCc1cc(-c2c[nH]c(=S)n2-c2ccc3c(c2)c2c(n3C)CCCC2)c(O)cc1N=O |
| InChI | InChI=1S/C24H24N4O2S/c1-3-14-10-18(23(29)12-19(14)26-30)22-13-25-24(31)28(22)15-8-9-21-17(11-15)16-6-4-5-7-20(16)27(21)2/h8-13,29H,3-7H2,1-2H3,(H,25,31) |
| InChIKey | KCCCWESHLAJNIH-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 75.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|