About N'-(5-methyl-1,2-oxazol-4-yl)-N-propylmethanediimine
N'-(5-methyl-1,2-oxazol-4-yl)-N-propylmethanediimine (PubChem CID 14341228) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is N'-(5-methyl-1,2-oxazol-4-yl)-N-propylmethanediimine.
Molecular Properties
| Compound Name | N'-(5-methyl-1,2-oxazol-4-yl)-N-propylmethanediimine |
| PubChem CID | 14341228 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | N'-(5-methyl-1,2-oxazol-4-yl)-N-propylmethanediimine |
| SMILES | CCCN=C=Nc1cnoc1C |
| InChI | InChI=1S/C8H11N3O/c1-3-4-9-6-10-8-5-11-12-7(8)2/h5H,3-4H2,1-2H3 |
| InChIKey | BGWPWHOYKNMJPI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-methyl-1,2-oxazol-4-yl)-N-propylmethanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-methyl-1,2-oxazol-4-yl)-N-propylmethanediimine?
The IUPAC name of N'-(5-methyl-1,2-oxazol-4-yl)-N-propylmethanediimine (CID 14341228) is N'-(5-methyl-1,2-oxazol-4-yl)-N-propylmethanediimine.
What is the SMILES notation for N'-(5-methyl-1,2-oxazol-4-yl)-N-propylmethanediimine?
The canonical SMILES for N'-(5-methyl-1,2-oxazol-4-yl)-N-propylmethanediimine is CCCN=C=Nc1cnoc1C.
What is the InChIKey of N'-(5-methyl-1,2-oxazol-4-yl)-N-propylmethanediimine?
The InChIKey is BGWPWHOYKNMJPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-3-4-9-6-10-8-5-11-12-7(8)2/h5H,3-4H2,1-2H3.
What are the key properties of N'-(5-methyl-1,2-oxazol-4-yl)-N-propylmethanediimine?
N'-(5-methyl-1,2-oxazol-4-yl)-N-propylmethanediimine has a molecular weight of 165.20 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-methyl-1,2-oxazol-4-yl)-N-propylmethanediimine is sourced from PubChem (CID 14341228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).