About N-(5-methyl-1,2-oxazol-4-yl)-N'-propan-2-ylmethanediimine
N-(5-methyl-1,2-oxazol-4-yl)-N'-propan-2-ylmethanediimine (PubChem CID 14341229) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-4-yl)-N'-propan-2-ylmethanediimine.
Molecular Properties
| Compound Name | N-(5-methyl-1,2-oxazol-4-yl)-N'-propan-2-ylmethanediimine |
| PubChem CID | 14341229 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-4-yl)-N'-propan-2-ylmethanediimine |
| SMILES | Cc1oncc1N=C=NC(C)C |
| InChI | InChI=1S/C8H11N3O/c1-6(2)9-5-10-8-4-11-12-7(8)3/h4,6H,1-3H3 |
| InChIKey | QNIIKGYDTVYFAT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(5-methyl-1,2-oxazol-4-yl)-N'-propan-2-ylmethanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methyl-1,2-oxazol-4-yl)-N'-propan-2-ylmethanediimine?
The IUPAC name of N-(5-methyl-1,2-oxazol-4-yl)-N'-propan-2-ylmethanediimine (CID 14341229) is N-(5-methyl-1,2-oxazol-4-yl)-N'-propan-2-ylmethanediimine.
What is the SMILES notation for N-(5-methyl-1,2-oxazol-4-yl)-N'-propan-2-ylmethanediimine?
The canonical SMILES for N-(5-methyl-1,2-oxazol-4-yl)-N'-propan-2-ylmethanediimine is Cc1oncc1N=C=NC(C)C.
What is the InChIKey of N-(5-methyl-1,2-oxazol-4-yl)-N'-propan-2-ylmethanediimine?
The InChIKey is QNIIKGYDTVYFAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-6(2)9-5-10-8-4-11-12-7(8)3/h4,6H,1-3H3.
What are the key properties of N-(5-methyl-1,2-oxazol-4-yl)-N'-propan-2-ylmethanediimine?
N-(5-methyl-1,2-oxazol-4-yl)-N'-propan-2-ylmethanediimine has a molecular weight of 165.20 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methyl-1,2-oxazol-4-yl)-N'-propan-2-ylmethanediimine is sourced from PubChem (CID 14341229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).