C17H24N2OS — CID 143412326
4-[(E)-but-2-en-2-yl]-5-[(2E,4Z)-2-hydroxy-5-propan-2-ylhepta-2,4,6-trienyl]-1,2-dihydropyrazole-3-thione (PubChem CID 143412326) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is 4-[(E)-but-2-en-2-yl]-5-[(2E,4Z)-2-hydroxy-5-propan-2-ylhepta-2,4,6-trienyl]-1,2-dihydropyrazole-3-thione.
| Compound Name | 4-[(E)-but-2-en-2-yl]-5-[(2E,4Z)-2-hydroxy-5-propan-2-ylhepta-2,4,6-trienyl]-1,2-dihydropyrazole-3-thione |
|---|---|
| PubChem CID | 143412326 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 4-[(E)-but-2-en-2-yl]-5-[(2E,4Z)-2-hydroxy-5-propan-2-ylhepta-2,4,6-trienyl]-1,2-dihydropyrazole-3-thione |
| SMILES | C=C/C(=C\C=C(\O)Cc1[nH][nH]c(=S)c1/C(C)=C/C)C(C)C |
| InChI | InChI=1S/C17H24N2OS/c1-6-12(5)16-15(18-19-17(16)21)10-14(20)9-8-13(7-2)11(3)4/h6-9,11,20H,2,10H2,1,3-5H3,(H2,18,19,21)/b12-6+,13-8+,14-9+ |
| InChIKey | XEUYOJONFXMZFK-CINWQUDRSA-N |
| XLogP | 5.25 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|