C25H34N2O3S — CID 143412333
5-(5-cyclopropyl-2,4-dihydroxyphenyl)-4-(4-methoxy-3-methylphenyl)-1,2-dihydropyrazole-3-thione;ethane;propane (PubChem CID 143412333) has the molecular formula C25H34N2O3S and a molecular weight of 442.63 g/mol. Its IUPAC name is 5-(5-cyclopropyl-2,4-dihydroxyphenyl)-4-(4-methoxy-3-methylphenyl)-1,2-dihydropyrazole-3-thione;ethane;propane.
| Compound Name | 5-(5-cyclopropyl-2,4-dihydroxyphenyl)-4-(4-methoxy-3-methylphenyl)-1,2-dihydropyrazole-3-thione;ethane;propane |
|---|---|
| PubChem CID | 143412333 |
| Molecular Formula | C25H34N2O3S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 5-(5-cyclopropyl-2,4-dihydroxyphenyl)-4-(4-methoxy-3-methylphenyl)-1,2-dihydropyrazole-3-thione;ethane;propane |
| SMILES | CC.CCC.COc1ccc(-c2c(-c3cc(C4CC4)c(O)cc3O)[nH][nH]c2=S)cc1C |
| InChI | InChI=1S/C20H20N2O3S.C3H8.C2H6/c1-10-7-12(5-6-17(10)25-2)18-19(21-22-20(18)26)14-8-13(11-3-4-11)15(23)9-16(14)24;1-3-2;1-2/h5-9,11,23-24H,3-4H2,1-2H3,(H2,21,22,26);3H2,1-2H3;1-2H3 |
| InChIKey | VAGFZMXZFMLODH-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 81.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|