C41H43Cl2N5O2 — CID 143412451
2-[4-[(5R)-5-benzyl-1-[3-(3,4-dichlorophenyl)benzoyl]-4-[2-(6,7-dihydronaphthalen-2-yl)acetyl]piperazin-2-yl]butyl]guanidine (PubChem CID 143412451) has the molecular formula C41H43Cl2N5O2 and a molecular weight of 708.73 g/mol. Its IUPAC name is 2-[4-[(5R)-5-benzyl-1-[3-(3,4-dichlorophenyl)benzoyl]-4-[2-(6,7-dihydronaphthalen-2-yl)acetyl]piperazin-2-yl]butyl]guanidine.
| Compound Name | 2-[4-[(5R)-5-benzyl-1-[3-(3,4-dichlorophenyl)benzoyl]-4-[2-(6,7-dihydronaphthalen-2-yl)acetyl]piperazin-2-yl]butyl]guanidine |
|---|---|
| PubChem CID | 143412451 |
| Molecular Formula | C41H43Cl2N5O2 |
| Molecular Weight | 708.73 g/mol |
| Exact Mass | 707.28 |
| IUPAC Name | 2-[4-[(5R)-5-benzyl-1-[3-(3,4-dichlorophenyl)benzoyl]-4-[2-(6,7-dihydronaphthalen-2-yl)acetyl]piperazin-2-yl]butyl]guanidine |
| SMILES | NC(N)=NCCCCC1CN(C(=O)Cc2ccc3c(c2)=CCCC=3)[C@H](Cc2ccccc2)CN1C(=O)c1cccc(-c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C41H43Cl2N5O2/c42-37-19-18-33(25-38(37)43)32-13-8-14-34(24-32)40(50)48-27-36(22-28-9-2-1-3-10-28)47(26-35(48)15-6-7-20-46-41(44)45)39(49)23-29-16-17-30-11-4-5-12-31(30)21-29/h1-3,8-14,16-19,21,24-25,35-36H,4-7,15,20,22-23,26-27H2,(H4,44,45,46)/t35?,36-/m1/s1 |
| InChIKey | QODOQQCMBNWODJ-BEBVUIBBSA-N |
| XLogP | 5.97 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.73 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|