C43H49Cl2N5O2 — CID 143412468
2-[3-[(5R)-5-benzyl-1-[3-(3,5-dichlorophenyl)benzoyl]-4-[2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)acetyl]piperazin-2-yl]propyl]guanidine;ethane (PubChem CID 143412468) has the molecular formula C43H49Cl2N5O2 and a molecular weight of 738.80 g/mol. Its IUPAC name is 2-[3-[(5R)-5-benzyl-1-[3-(3,5-dichlorophenyl)benzoyl]-4-[2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)acetyl]piperazin-2-yl]propyl]guanidine;ethane.
| Compound Name | 2-[3-[(5R)-5-benzyl-1-[3-(3,5-dichlorophenyl)benzoyl]-4-[2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)acetyl]piperazin-2-yl]propyl]guanidine;ethane |
|---|---|
| PubChem CID | 143412468 |
| Molecular Formula | C43H49Cl2N5O2 |
| Molecular Weight | 738.80 g/mol |
| Exact Mass | 737.33 |
| IUPAC Name | 2-[3-[(5R)-5-benzyl-1-[3-(3,5-dichlorophenyl)benzoyl]-4-[2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)acetyl]piperazin-2-yl]propyl]guanidine;ethane |
| SMILES | CC.NC(N)=NCCCC1CN(C(=O)CC2=Cc3ccccc3CCC2)[C@H](Cc2ccccc2)CN1C(=O)c1cccc(-c2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C41H43Cl2N5O2.C2H6/c42-35-23-34(24-36(43)25-35)32-15-7-16-33(22-32)40(50)48-27-38(20-28-9-2-1-3-10-28)47(26-37(48)17-8-18-46-41(44)45)39(49)21-29-11-6-14-30-12-4-5-13-31(30)19-29;1-2/h1-5,7,9-10,12-13,15-16,19,22-25,37-38H,6,8,11,14,17-18,20-21,26-27H2,(H4,44,45,46);1-2H3/t37?,38-;/m1./s1 |
| InChIKey | YFKHENASCWIXTQ-KQWGQSANSA-N |
| XLogP | 8.81 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.80 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|