C17H19N5 — CID 143412679
5-methyl-11-[(E)-(2-methyl-4-methylidenepyrazol-3-ylidene)methyl]-3,4,13-triazatricyclo[8.3.0.02,6]trideca-1(10),2,5,11-tetraene (PubChem CID 143412679) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is 5-methyl-11-[(E)-(2-methyl-4-methylidenepyrazol-3-ylidene)methyl]-3,4,13-triazatricyclo[8.3.0.02,6]trideca-1(10),2,5,11-tetraene.
| Compound Name | 5-methyl-11-[(E)-(2-methyl-4-methylidenepyrazol-3-ylidene)methyl]-3,4,13-triazatricyclo[8.3.0.02,6]trideca-1(10),2,5,11-tetraene |
|---|---|
| PubChem CID | 143412679 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 5-methyl-11-[(E)-(2-methyl-4-methylidenepyrazol-3-ylidene)methyl]-3,4,13-triazatricyclo[8.3.0.02,6]trideca-1(10),2,5,11-tetraene |
| SMILES | C=c1cnn(C)/c1=C/c1c[nH]c2c1CCCc1c-2n[nH]c1C |
| InChI | InChI=1S/C17H19N5/c1-10-8-19-22(3)15(10)7-12-9-18-16-14(12)6-4-5-13-11(2)20-21-17(13)16/h7-9,18H,1,4-6H2,2-3H3,(H,20,21)/b15-7+ |
| InChIKey | IUMINMHSIOIEES-VIZOYTHASA-N |
| XLogP | 1.17 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |