About N-(5-bromocyclohexa-1,5-dien-1-yl)acetamide
N-(5-bromocyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 143412987) has the molecular formula C8H10BrNO
and a molecular weight of 216.08 g/mol. Its IUPAC name is N-(5-bromocyclohexa-1,5-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(5-bromocyclohexa-1,5-dien-1-yl)acetamide |
| PubChem CID | 143412987 |
| Molecular Formula | C8H10BrNO |
| Molecular Weight | 216.08 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | N-(5-bromocyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1=CCCC(Br)=C1 |
| InChI | InChI=1S/C8H10BrNO/c1-6(11)10-8-4-2-3-7(9)5-8/h4-5H,2-3H2,1H3,(H,10,11) |
| InChIKey | PSXSDSKEONNLQL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.08 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(5-bromocyclohexa-1,5-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromocyclohexa-1,5-dien-1-yl)acetamide?
The IUPAC name of N-(5-bromocyclohexa-1,5-dien-1-yl)acetamide (CID 143412987) is N-(5-bromocyclohexa-1,5-dien-1-yl)acetamide.
What is the SMILES notation for N-(5-bromocyclohexa-1,5-dien-1-yl)acetamide?
The canonical SMILES for N-(5-bromocyclohexa-1,5-dien-1-yl)acetamide is CC(=O)NC1=CCCC(Br)=C1.
What is the InChIKey of N-(5-bromocyclohexa-1,5-dien-1-yl)acetamide?
The InChIKey is PSXSDSKEONNLQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrNO/c1-6(11)10-8-4-2-3-7(9)5-8/h4-5H,2-3H2,1H3,(H,10,11).
What are the key properties of N-(5-bromocyclohexa-1,5-dien-1-yl)acetamide?
N-(5-bromocyclohexa-1,5-dien-1-yl)acetamide has a molecular weight of 216.08 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromocyclohexa-1,5-dien-1-yl)acetamide is sourced from PubChem (CID 143412987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).