C19H31ClN4O2 — CID 143413560
1-[4-[(2E,4E)-6-chloro-5-methoxyhepta-2,4,6-trien-3-yl]piperazin-1-yl]-2-(4-methylpiperazin-1-yl)ethanone (PubChem CID 143413560) has the molecular formula C19H31ClN4O2 and a molecular weight of 382.94 g/mol. Its IUPAC name is 1-[4-[(2E,4E)-6-chloro-5-methoxyhepta-2,4,6-trien-3-yl]piperazin-1-yl]-2-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 1-[4-[(2E,4E)-6-chloro-5-methoxyhepta-2,4,6-trien-3-yl]piperazin-1-yl]-2-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 143413560 |
| Molecular Formula | C19H31ClN4O2 |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-[4-[(2E,4E)-6-chloro-5-methoxyhepta-2,4,6-trien-3-yl]piperazin-1-yl]-2-(4-methylpiperazin-1-yl)ethanone |
| SMILES | C=C(Cl)/C(=C/C(=C\C)N1CCN(C(=O)CN2CCN(C)CC2)CC1)OC |
| InChI | InChI=1S/C19H31ClN4O2/c1-5-17(14-18(26-4)16(2)20)23-10-12-24(13-11-23)19(25)15-22-8-6-21(3)7-9-22/h5,14H,2,6-13,15H2,1,3-4H3/b17-5+,18-14+ |
| InChIKey | IGGVIXAJUNFKLU-FQYYDQKYSA-N |
| XLogP | 1.56 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|