C6H6FN3 — CID 143413676
1-[(1Z)-2-fluorobuta-1,3-dienyl]-1,2,4-triazole (PubChem CID 143413676) has the molecular formula C6H6FN3 and a molecular weight of 139.13 g/mol. Its IUPAC name is 1-[(1Z)-2-fluorobuta-1,3-dienyl]-1,2,4-triazole.
| Compound Name | 1-[(1Z)-2-fluorobuta-1,3-dienyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 143413676 |
| Molecular Formula | C6H6FN3 |
| Molecular Weight | 139.13 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 1-[(1Z)-2-fluorobuta-1,3-dienyl]-1,2,4-triazole |
| SMILES | C=C/C(F)=C/n1cncn1 |
| InChI | InChI=1S/C6H6FN3/c1-2-6(7)3-10-5-8-4-9-10/h2-5H,1H2/b6-3- |
| InChIKey | XEJIKDQGLPRBJO-UTCJRWHESA-N |
| XLogP | 1.23 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.13 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|