C11H14N2 — CID 143413753
1-[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]pyrazole (PubChem CID 143413753) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 1-[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]pyrazole.
| Compound Name | 1-[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]pyrazole |
|---|---|
| PubChem CID | 143413753 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]pyrazole |
| SMILES | C=C(/C(C)=C\C=C/C)n1cccn1 |
| InChI | InChI=1S/C11H14N2/c1-4-5-7-10(2)11(3)13-9-6-8-12-13/h4-9H,3H2,1-2H3/b5-4-,10-7- |
| InChIKey | POFWYLSFQYXEDQ-WKBXPBOGSA-N |
| XLogP | 2.88 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|