C9H12N4 — CID 143413781
(3E,5Z)-7-(1,2,4-triazol-1-yl)hepta-1,3,5-trien-4-amine (PubChem CID 143413781) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is (3E,5Z)-7-(1,2,4-triazol-1-yl)hepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-7-(1,2,4-triazol-1-yl)hepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 143413781 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | (3E,5Z)-7-(1,2,4-triazol-1-yl)hepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(N)\C=C/Cn1cncn1 |
| InChI | InChI=1S/C9H12N4/c1-2-4-9(10)5-3-6-13-8-11-7-12-13/h2-5,7-8H,1,6,10H2/b5-3-,9-4+ |
| InChIKey | SRCGHQYTSRPGNI-LWUTYWFWSA-N |
| XLogP | 0.86 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|