About N-benzyl-N-[(Z)-2-(6,7-dimethoxyquinazolin-4-yl)ethylideneamino]ethanamine;ethane;formic acid
N-benzyl-N-[(Z)-2-(6,7-dimethoxyquinazolin-4-yl)ethylideneamino]ethanamine;ethane;formic acid (PubChem CID 143413827) has the molecular formula C24H32N4O4
and a molecular weight of 440.54 g/mol. Its IUPAC name is N-benzyl-N-[(Z)-2-(6,7-dimethoxyquinazolin-4-yl)ethylideneamino]ethanamine;ethane;formic acid.
Molecular Properties
| Compound Name | N-benzyl-N-[(Z)-2-(6,7-dimethoxyquinazolin-4-yl)ethylideneamino]ethanamine;ethane;formic acid |
| PubChem CID | 143413827 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | N-benzyl-N-[(Z)-2-(6,7-dimethoxyquinazolin-4-yl)ethylideneamino]ethanamine;ethane;formic acid |
| SMILES | CC.CCN(Cc1ccccc1)/N=C\Cc1ncnc2cc(OC)c(OC)cc12.O=CO |
| InChI | InChI=1S/C21H24N4O2.C2H6.CH2O2/c1-4-25(14-16-8-6-5-7-9-16)24-11-10-18-17-12-20(26-2)21(27-3)13-19(17)23-15-22-18;1-2;2-1-3/h5-9,11-13,15H,4,10,14H2,1-3H3;1-2H3;1H,(H,2,3)/b24-11-;; |
| InChIKey | WSDKSGSBJJJTHO-SAOHPKBSSA-N |
| XLogP | 4.42 |
| TPSA | 97.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N-[(Z)-2-(6,7-dimethoxyquinazolin-4-yl)ethylideneamino]ethanamine;ethane;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-[(Z)-2-(6,7-dimethoxyquinazolin-4-yl)ethylideneamino]ethanamine;ethane;formic acid?
The IUPAC name of N-benzyl-N-[(Z)-2-(6,7-dimethoxyquinazolin-4-yl)ethylideneamino]ethanamine;ethane;formic acid (CID 143413827) is N-benzyl-N-[(Z)-2-(6,7-dimethoxyquinazolin-4-yl)ethylideneamino]ethanamine;ethane;formic acid.
What is the SMILES notation for N-benzyl-N-[(Z)-2-(6,7-dimethoxyquinazolin-4-yl)ethylideneamino]ethanamine;ethane;formic acid?
The canonical SMILES for N-benzyl-N-[(Z)-2-(6,7-dimethoxyquinazolin-4-yl)ethylideneamino]ethanamine;ethane;formic acid is CC.CCN(Cc1ccccc1)/N=C\Cc1ncnc2cc(OC)c(OC)cc12.O=CO.
What is the InChIKey of N-benzyl-N-[(Z)-2-(6,7-dimethoxyquinazolin-4-yl)ethylideneamino]ethanamine;ethane;formic acid?
The InChIKey is WSDKSGSBJJJTHO-SAOHPKBSSA-N. The full InChI is InChI=1S/C21H24N4O2.C2H6.CH2O2/c1-4-25(14-16-8-6-5-7-9-16)24-11-10-18-17-12-20(26-2)21(27-3)13-19(17)23-15-22-18;1-2;2-1-3/h5-9,11-13,15H,4,10,14H2,1-3H3;1-2H3;1H,(H,2,3)/b24-11-;;.
What are the key properties of N-benzyl-N-[(Z)-2-(6,7-dimethoxyquinazolin-4-yl)ethylideneamino]ethanamine;ethane;formic acid?
N-benzyl-N-[(Z)-2-(6,7-dimethoxyquinazolin-4-yl)ethylideneamino]ethanamine;ethane;formic acid has a molecular weight of 440.54 g/mol, XLogP of 4.42, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-[(Z)-2-(6,7-dimethoxyquinazolin-4-yl)ethylideneamino]ethanamine;ethane;formic acid is sourced from PubChem (CID 143413827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).