About ethanol;1-fluoro-2,3-dimethylidenecyclohexane
ethanol;1-fluoro-2,3-dimethylidenecyclohexane (PubChem CID 143414186) has the molecular formula C10H17FO
and a molecular weight of 172.24 g/mol. Its IUPAC name is ethanol;1-fluoro-2,3-dimethylidenecyclohexane.
Molecular Properties
| Compound Name | ethanol;1-fluoro-2,3-dimethylidenecyclohexane |
| PubChem CID | 143414186 |
| Molecular Formula | C10H17FO |
| Molecular Weight | 172.24 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | ethanol;1-fluoro-2,3-dimethylidenecyclohexane |
| SMILES | C=C1CCCC(F)C1=C.CCO |
| InChI | InChI=1S/C8H11F.C2H6O/c1-6-4-3-5-8(9)7(6)2;1-2-3/h8H,1-5H2;3H,2H2,1H3 |
| InChIKey | BAMPBSLQIQDWJW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethanol;1-fluoro-2,3-dimethylidenecyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;1-fluoro-2,3-dimethylidenecyclohexane?
The IUPAC name of ethanol;1-fluoro-2,3-dimethylidenecyclohexane (CID 143414186) is ethanol;1-fluoro-2,3-dimethylidenecyclohexane.
What is the SMILES notation for ethanol;1-fluoro-2,3-dimethylidenecyclohexane?
The canonical SMILES for ethanol;1-fluoro-2,3-dimethylidenecyclohexane is C=C1CCCC(F)C1=C.CCO.
What is the InChIKey of ethanol;1-fluoro-2,3-dimethylidenecyclohexane?
The InChIKey is BAMPBSLQIQDWJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F.C2H6O/c1-6-4-3-5-8(9)7(6)2;1-2-3/h8H,1-5H2;3H,2H2,1H3.
What are the key properties of ethanol;1-fluoro-2,3-dimethylidenecyclohexane?
ethanol;1-fluoro-2,3-dimethylidenecyclohexane has a molecular weight of 172.24 g/mol, XLogP of 2.62, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;1-fluoro-2,3-dimethylidenecyclohexane is sourced from PubChem (CID 143414186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).