C26H34O2 — CID 143414269
2-(4-methylphenyl)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxane (PubChem CID 143414269) has the molecular formula C26H34O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 2-(4-methylphenyl)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxane.
| Compound Name | 2-(4-methylphenyl)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 143414269 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 2-(4-methylphenyl)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxane |
| SMILES | Cc1ccc(C2(c3cc4c(cc3C)C(C)(C)CCC4(C)C)OCCCO2)cc1 |
| InChI | InChI=1S/C26H34O2/c1-18-8-10-20(11-9-18)26(27-14-7-15-28-26)21-17-23-22(16-19(21)2)24(3,4)12-13-25(23,5)6/h8-11,16-17H,7,12-15H2,1-6H3 |
| InChIKey | JTQQIHACIMCBGF-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |