C27H30Cl2N4S — CID 143414936
N-[3-[(1R,5S)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanylmethyl]-N,2-dimethylquinoline-5-carboximidamide (PubChem CID 143414936) has the molecular formula C27H30Cl2N4S and a molecular weight of 513.54 g/mol. Its IUPAC name is N-[3-[(1R,5S)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanylmethyl]-N,2-dimethylquinoline-5-carboximidamide.
| Compound Name | N-[3-[(1R,5S)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanylmethyl]-N,2-dimethylquinoline-5-carboximidamide |
|---|---|
| PubChem CID | 143414936 |
| Molecular Formula | C27H30Cl2N4S |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | N-[3-[(1R,5S)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanylmethyl]-N,2-dimethylquinoline-5-carboximidamide |
| SMILES | [H]/N=C(/c1cccc2nc(C)ccc12)N(C)CSCCCN1C[C@H]2C[C@@]2(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C27H30Cl2N4S/c1-18-7-9-21-22(5-3-6-25(21)31-18)26(30)32(2)17-34-12-4-11-33-15-20-14-27(20,16-33)19-8-10-23(28)24(29)13-19/h3,5-10,13,20,30H,4,11-12,14-17H2,1-2H3/b30-26-/t20-,27+/m1/s1 |
| InChIKey | CSXAKPQNYSWVLP-JHDFWYLBSA-N |
| XLogP | 6.46 |
| TPSA | 43.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|