C25H31N5O3 — CID 143415228
(1-cyclopentyl-3-pyridin-4-ylpropyl) (E)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3-hydroxybut-2-enoate (PubChem CID 143415228) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is (1-cyclopentyl-3-pyridin-4-ylpropyl) (E)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3-hydroxybut-2-enoate.
| Compound Name | (1-cyclopentyl-3-pyridin-4-ylpropyl) (E)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 143415228 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | (1-cyclopentyl-3-pyridin-4-ylpropyl) (E)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3-hydroxybut-2-enoate |
| SMILES | C/C(O)=C(/Cc1nc2nc(C)cc(C)n2n1)C(=O)OC(CCc1ccncc1)C1CCCC1 |
| InChI | InChI=1S/C25H31N5O3/c1-16-14-17(2)30-25(27-16)28-23(29-30)15-21(18(3)31)24(32)33-22(20-6-4-5-7-20)9-8-19-10-12-26-13-11-19/h10-14,20,22,31H,4-9,15H2,1-3H3/b21-18+ |
| InChIKey | ZEUWMXHODYHHRF-DYTRJAOYSA-N |
| XLogP | 4.25 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|