About methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene
methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene (PubChem CID 143415322) has the molecular formula C19H28
and a molecular weight of 256.43 g/mol. Its IUPAC name is methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene.
Molecular Properties
| Compound Name | methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene |
| PubChem CID | 143415322 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene |
| SMILES | C.CCCCCC1=CC=C(c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C18H24.CH4/c1-3-4-5-6-16-9-13-18(14-10-16)17-11-7-15(2)8-12-17;/h7-9,11-13H,3-6,10,14H2,1-2H3;1H4 |
| InChIKey | RROSSEQVSIIEQD-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene?
The IUPAC name of methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene (CID 143415322) is methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene.
What is the SMILES notation for methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene?
The canonical SMILES for methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene is C.CCCCCC1=CC=C(c2ccc(C)cc2)CC1.
What is the InChIKey of methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene?
The InChIKey is RROSSEQVSIIEQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24.CH4/c1-3-4-5-6-16-9-13-18(14-10-16)17-11-7-15(2)8-12-17;/h7-9,11-13H,3-6,10,14H2,1-2H3;1H4.
What are the key properties of methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene?
methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene has a molecular weight of 256.43 g/mol, XLogP of 6.32, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene is sourced from PubChem (CID 143415322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).