C19H28 — CID 143415322
methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene (PubChem CID 143415322) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene.
| Compound Name | methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene |
|---|---|
| PubChem CID | 143415322 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | methane;1-methyl-4-(4-pentylcyclohexa-1,3-dien-1-yl)benzene |
| SMILES | C.CCCCCC1=CC=C(c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C18H24.CH4/c1-3-4-5-6-16-9-13-18(14-10-16)17-11-7-15(2)8-12-17;/h7-9,11-13H,3-6,10,14H2,1-2H3;1H4 |
| InChIKey | RROSSEQVSIIEQD-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|