C8H12FNO — CID 143415585
(2E,4E)-1-fluoro-5-methoxyhepta-2,4,6-trien-2-amine (PubChem CID 143415585) has the molecular formula C8H12FNO and a molecular weight of 157.19 g/mol. Its IUPAC name is (2E,4E)-1-fluoro-5-methoxyhepta-2,4,6-trien-2-amine.
| Compound Name | (2E,4E)-1-fluoro-5-methoxyhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 143415585 |
| Molecular Formula | C8H12FNO |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (2E,4E)-1-fluoro-5-methoxyhepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(=C\C=C(\N)CF)OC |
| InChI | InChI=1S/C8H12FNO/c1-3-8(11-2)5-4-7(10)6-9/h3-5H,1,6,10H2,2H3/b7-4+,8-5+ |
| InChIKey | DYMOEZDOZCKHFF-NSLJXJERSA-N |
| XLogP | 1.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|