About 1-[(Z)-2-ethenylbut-2-enyl]-2-methyl-4-nitrobenzene;methanamine;N-methylethanamine
1-[(Z)-2-ethenylbut-2-enyl]-2-methyl-4-nitrobenzene;methanamine;N-methylethanamine (PubChem CID 143415620) has the molecular formula C17H29N3O2
and a molecular weight of 307.44 g/mol. Its IUPAC name is 1-[(Z)-2-ethenylbut-2-enyl]-2-methyl-4-nitrobenzene;methanamine;N-methylethanamine.
Molecular Properties
| Compound Name | 1-[(Z)-2-ethenylbut-2-enyl]-2-methyl-4-nitrobenzene;methanamine;N-methylethanamine |
| PubChem CID | 143415620 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 1-[(Z)-2-ethenylbut-2-enyl]-2-methyl-4-nitrobenzene;methanamine;N-methylethanamine |
| SMILES | C=C/C(=C\C)Cc1ccc([N+](=O)[O-])cc1C.CCNC.CN |
| InChI | InChI=1S/C13H15NO2.C3H9N.CH5N/c1-4-11(5-2)9-12-6-7-13(14(15)16)8-10(12)3;1-3-4-2;1-2/h4-8H,1,9H2,2-3H3;4H,3H2,1-2H3;2H2,1H3/b11-5+;; |
| InChIKey | DHOYZQACCHSKBX-JYENVBOSSA-N |
| XLogP | 3.38 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-2-ethenylbut-2-enyl]-2-methyl-4-nitrobenzene;methanamine;N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-2-ethenylbut-2-enyl]-2-methyl-4-nitrobenzene;methanamine;N-methylethanamine?
The IUPAC name of 1-[(Z)-2-ethenylbut-2-enyl]-2-methyl-4-nitrobenzene;methanamine;N-methylethanamine (CID 143415620) is 1-[(Z)-2-ethenylbut-2-enyl]-2-methyl-4-nitrobenzene;methanamine;N-methylethanamine.
What is the SMILES notation for 1-[(Z)-2-ethenylbut-2-enyl]-2-methyl-4-nitrobenzene;methanamine;N-methylethanamine?
The canonical SMILES for 1-[(Z)-2-ethenylbut-2-enyl]-2-methyl-4-nitrobenzene;methanamine;N-methylethanamine is C=C/C(=C\C)Cc1ccc([N+](=O)[O-])cc1C.CCNC.CN.
What is the InChIKey of 1-[(Z)-2-ethenylbut-2-enyl]-2-methyl-4-nitrobenzene;methanamine;N-methylethanamine?
The InChIKey is DHOYZQACCHSKBX-JYENVBOSSA-N. The full InChI is InChI=1S/C13H15NO2.C3H9N.CH5N/c1-4-11(5-2)9-12-6-7-13(14(15)16)8-10(12)3;1-3-4-2;1-2/h4-8H,1,9H2,2-3H3;4H,3H2,1-2H3;2H2,1H3/b11-5+;;.
What are the key properties of 1-[(Z)-2-ethenylbut-2-enyl]-2-methyl-4-nitrobenzene;methanamine;N-methylethanamine?
1-[(Z)-2-ethenylbut-2-enyl]-2-methyl-4-nitrobenzene;methanamine;N-methylethanamine has a molecular weight of 307.44 g/mol, XLogP of 3.38, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-2-ethenylbut-2-enyl]-2-methyl-4-nitrobenzene;methanamine;N-methylethanamine is sourced from PubChem (CID 143415620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).