About CID 143415779
CID 143415779 (PubChem CID 143415779) has the molecular formula C10H23NOSi-
and a molecular weight of 201.39 g/mol.
Molecular Properties
| Compound Name | CID 143415779 |
| PubChem CID | 143415779 |
| Molecular Formula | C10H23NOSi- |
| Molecular Weight | 201.39 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si-](C)(C)OC1CCNC1 |
| InChI | InChI=1S/C10H23NOSi/c1-10(2,3)13(4,5)12-9-6-7-11-8-9/h9,11H,6-8H2,1-5H3/q-1 |
| InChIKey | VUACSELJPQWUQV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 143415779 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143415779?
The IUPAC name of CID 143415779 (CID 143415779) is not available.
What is the SMILES notation for CID 143415779?
The canonical SMILES for CID 143415779 is CC(C)(C)[Si-](C)(C)OC1CCNC1.
What is the InChIKey of CID 143415779?
The InChIKey is VUACSELJPQWUQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NOSi/c1-10(2,3)13(4,5)12-9-6-7-11-8-9/h9,11H,6-8H2,1-5H3/q-1.
What are the key properties of CID 143415779?
CID 143415779 has a molecular weight of 201.39 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143415779 is sourced from PubChem (CID 143415779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).