C30H34N6O2 — CID 143415938
13-(1-aminoethenyl)-2-[2-[2-[(1S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]prop-2-enylamino]ethyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-2,6-dicarboxamide (PubChem CID 143415938) has the molecular formula C30H34N6O2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 13-(1-aminoethenyl)-2-[2-[2-[(1S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]prop-2-enylamino]ethyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-2,6-dicarboxamide.
| Compound Name | 13-(1-aminoethenyl)-2-[2-[2-[(1S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]prop-2-enylamino]ethyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 143415938 |
| Molecular Formula | C30H34N6O2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 13-(1-aminoethenyl)-2-[2-[2-[(1S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]prop-2-enylamino]ethyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-2,6-dicarboxamide |
| SMILES | C=C(N)c1ccc2c(c1)CCc1cc(C(N)=O)ccc1C2(CCNCC(=C)N1C(C#N)C[C@@H]2C[C@@H]21)C(N)=O |
| InChI | InChI=1S/C30H34N6O2/c1-17(36-24(15-31)13-23-14-27(23)36)16-35-10-9-30(29(34)38)25-7-5-19(18(2)32)11-20(25)3-4-21-12-22(28(33)37)6-8-26(21)30/h5-8,11-12,23-24,27,35H,1-4,9-10,13-14,16,32H2,(H2,33,37)(H2,34,38)/t23-,24?,27+,30?/m1/s1 |
| InChIKey | JULGPEIYQBPUGM-MKLUXGSISA-N |
| XLogP | 2.06 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|