C21H20N4 — CID 143417117
4-(5,6,7,8,9,10-hexahydroimidazo[1,5-a]azocin-5-yl)-3-pyridin-3-ylbenzonitrile (PubChem CID 143417117) has the molecular formula C21H20N4 and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-(5,6,7,8,9,10-hexahydroimidazo[1,5-a]azocin-5-yl)-3-pyridin-3-ylbenzonitrile.
| Compound Name | 4-(5,6,7,8,9,10-hexahydroimidazo[1,5-a]azocin-5-yl)-3-pyridin-3-ylbenzonitrile |
|---|---|
| PubChem CID | 143417117 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 4-(5,6,7,8,9,10-hexahydroimidazo[1,5-a]azocin-5-yl)-3-pyridin-3-ylbenzonitrile |
| SMILES | N#Cc1ccc(C2CCCCCc3cncn32)c(-c2cccnc2)c1 |
| InChI | InChI=1S/C21H20N4/c22-12-16-8-9-19(20(11-16)17-5-4-10-23-13-17)21-7-3-1-2-6-18-14-24-15-25(18)21/h4-5,8-11,13-15,21H,1-3,6-7H2 |
| InChIKey | LVVMKKNFZCHDQT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |