C17H24N4O4 — CID 143417281
formic acid;4-(1H-imidazol-5-ylmethyl)-N-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-amine (PubChem CID 143417281) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is formic acid;4-(1H-imidazol-5-ylmethyl)-N-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-amine.
| Compound Name | formic acid;4-(1H-imidazol-5-ylmethyl)-N-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-amine |
|---|---|
| PubChem CID | 143417281 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | formic acid;4-(1H-imidazol-5-ylmethyl)-N-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-amine |
| SMILES | COCCCNc1ccc2c(c1)N(Cc1cnc[nH]1)CCO2.O=CO |
| InChI | InChI=1S/C16H22N4O2.CH2O2/c1-21-7-2-5-18-13-3-4-16-15(9-13)20(6-8-22-16)11-14-10-17-12-19-14;2-1-3/h3-4,9-10,12,18H,2,5-8,11H2,1H3,(H,17,19);1H,(H,2,3) |
| InChIKey | NNQUVAOPHSSOQS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|