About 3-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydrocyclopenta[c]isoquinolin-5-one;ethane
3-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydrocyclopenta[c]isoquinolin-5-one;ethane (PubChem CID 143417395) has the molecular formula C21H27NO
and a molecular weight of 309.45 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydrocyclopenta[c]isoquinolin-5-one;ethane.
Molecular Properties
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydrocyclopenta[c]isoquinolin-5-one;ethane |
| PubChem CID | 143417395 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydrocyclopenta[c]isoquinolin-5-one;ethane |
| SMILES | C=C/C=C\C1=C(C)Cc2c1[nH]c(=O)c1ccccc21.CC.CC |
| InChI | InChI=1S/C17H15NO.2C2H6/c1-3-4-7-12-11(2)10-15-13-8-5-6-9-14(13)17(19)18-16(12)15;2*1-2/h3-9H,1,10H2,2H3,(H,18,19);2*1-2H3/b7-4-;; |
| InChIKey | DAXBXTVSRRQCQJ-XIFWRFGDSA-N |
| XLogP | 5.65 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydrocyclopenta[c]isoquinolin-5-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydrocyclopenta[c]isoquinolin-5-one;ethane?
The IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydrocyclopenta[c]isoquinolin-5-one;ethane (CID 143417395) is 3-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydrocyclopenta[c]isoquinolin-5-one;ethane.
What is the SMILES notation for 3-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydrocyclopenta[c]isoquinolin-5-one;ethane?
The canonical SMILES for 3-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydrocyclopenta[c]isoquinolin-5-one;ethane is C=C/C=C\C1=C(C)Cc2c1[nH]c(=O)c1ccccc21.CC.CC.
What is the InChIKey of 3-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydrocyclopenta[c]isoquinolin-5-one;ethane?
The InChIKey is DAXBXTVSRRQCQJ-XIFWRFGDSA-N. The full InChI is InChI=1S/C17H15NO.2C2H6/c1-3-4-7-12-11(2)10-15-13-8-5-6-9-14(13)17(19)18-16(12)15;2*1-2/h3-9H,1,10H2,2H3,(H,18,19);2*1-2H3/b7-4-;;.
What are the key properties of 3-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydrocyclopenta[c]isoquinolin-5-one;ethane?
3-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydrocyclopenta[c]isoquinolin-5-one;ethane has a molecular weight of 309.45 g/mol, XLogP of 5.65, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1Z)-buta-1,3-dienyl]-2-methyl-1,4-dihydrocyclopenta[c]isoquinolin-5-one;ethane is sourced from PubChem (CID 143417395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).