C10H17I — CID 14341787
8a-iodo-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene (PubChem CID 14341787) has the molecular formula C10H17I and a molecular weight of 264.15 g/mol. Its IUPAC name is 8a-iodo-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene.
| Compound Name | 8a-iodo-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene |
|---|---|
| PubChem CID | 14341787 |
| Molecular Formula | C10H17I |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 8a-iodo-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene |
| SMILES | IC12CCCCC1CCCC2 |
| InChI | InChI=1S/C10H17I/c11-10-7-3-1-5-9(10)6-2-4-8-10/h9H,1-8H2 |
| InChIKey | UJURKVGXIGIXHF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|