C27H33F3O5S — CID 14341814
[10,13-dimethyl-3-(trifluoromethylsulfonyloxy)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate (PubChem CID 14341814) has the molecular formula C27H33F3O5S and a molecular weight of 526.62 g/mol. Its IUPAC name is [10,13-dimethyl-3-(trifluoromethylsulfonyloxy)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate.
| Compound Name | [10,13-dimethyl-3-(trifluoromethylsulfonyloxy)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate |
|---|---|
| PubChem CID | 14341814 |
| Molecular Formula | C27H33F3O5S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | [10,13-dimethyl-3-(trifluoromethylsulfonyloxy)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate |
| SMILES | CC12CC=C(OS(=O)(=O)C(F)(F)F)CC1CCC1C2CCC2(C)C(OC(=O)c3ccccc3)CCC12 |
| InChI | InChI=1S/C27H33F3O5S/c1-25-14-12-19(35-36(32,33)27(28,29)30)16-18(25)8-9-20-21-10-11-23(26(21,2)15-13-22(20)25)34-24(31)17-6-4-3-5-7-17/h3-7,12,18,20-23H,8-11,13-16H2,1-2H3 |
| InChIKey | HUTCBYJEKZQQAE-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|