About [4-[4-(2-amino-3-fluoropropyl)phenyl]phenyl]methanol;ethane;methanol
[4-[4-(2-amino-3-fluoropropyl)phenyl]phenyl]methanol;ethane;methanol (PubChem CID 143418287) has the molecular formula C19H28FNO2
and a molecular weight of 321.44 g/mol. Its IUPAC name is [4-[4-(2-amino-3-fluoropropyl)phenyl]phenyl]methanol;ethane;methanol.
Molecular Properties
| Compound Name | [4-[4-(2-amino-3-fluoropropyl)phenyl]phenyl]methanol;ethane;methanol |
| PubChem CID | 143418287 |
| Molecular Formula | C19H28FNO2 |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | [4-[4-(2-amino-3-fluoropropyl)phenyl]phenyl]methanol;ethane;methanol |
| SMILES | CC.CO.NC(CF)Cc1ccc(-c2ccc(CO)cc2)cc1 |
| InChI | InChI=1S/C16H18FNO.C2H6.CH4O/c17-10-16(18)9-12-1-5-14(6-2-12)15-7-3-13(11-19)4-8-15;2*1-2/h1-8,16,19H,9-11,18H2;1-2H3;2H,1H3 |
| InChIKey | CQTGBXXDLXAMFY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[4-(2-amino-3-fluoropropyl)phenyl]phenyl]methanol;ethane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(2-amino-3-fluoropropyl)phenyl]phenyl]methanol;ethane;methanol?
The IUPAC name of [4-[4-(2-amino-3-fluoropropyl)phenyl]phenyl]methanol;ethane;methanol (CID 143418287) is [4-[4-(2-amino-3-fluoropropyl)phenyl]phenyl]methanol;ethane;methanol.
What is the SMILES notation for [4-[4-(2-amino-3-fluoropropyl)phenyl]phenyl]methanol;ethane;methanol?
The canonical SMILES for [4-[4-(2-amino-3-fluoropropyl)phenyl]phenyl]methanol;ethane;methanol is CC.CO.NC(CF)Cc1ccc(-c2ccc(CO)cc2)cc1.
What is the InChIKey of [4-[4-(2-amino-3-fluoropropyl)phenyl]phenyl]methanol;ethane;methanol?
The InChIKey is CQTGBXXDLXAMFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18FNO.C2H6.CH4O/c17-10-16(18)9-12-1-5-14(6-2-12)15-7-3-13(11-19)4-8-15;2*1-2/h1-8,16,19H,9-11,18H2;1-2H3;2H,1H3.
What are the key properties of [4-[4-(2-amino-3-fluoropropyl)phenyl]phenyl]methanol;ethane;methanol?
[4-[4-(2-amino-3-fluoropropyl)phenyl]phenyl]methanol;ethane;methanol has a molecular weight of 321.44 g/mol, XLogP of 3.32, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(2-amino-3-fluoropropyl)phenyl]phenyl]methanol;ethane;methanol is sourced from PubChem (CID 143418287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).