C23H37FO7 — CID 143418334
(3S,7R,9R,11R,12R,13S,14R)-7-ethenyl-14-ethyl-3-fluoro-12,13-dihydroxy-7-methoxy-3,5,9,11,13-pentamethyl-oxacyclotetradecane-2,4,10-trione (PubChem CID 143418334) has the molecular formula C23H37FO7 and a molecular weight of 444.54 g/mol. Its IUPAC name is (3S,7R,9R,11R,12R,13S,14R)-7-ethenyl-14-ethyl-3-fluoro-12,13-dihydroxy-7-methoxy-3,5,9,11,13-pentamethyl-oxacyclotetradecane-2,4,10-trione.
| Compound Name | (3S,7R,9R,11R,12R,13S,14R)-7-ethenyl-14-ethyl-3-fluoro-12,13-dihydroxy-7-methoxy-3,5,9,11,13-pentamethyl-oxacyclotetradecane-2,4,10-trione |
|---|---|
| PubChem CID | 143418334 |
| Molecular Formula | C23H37FO7 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | (3S,7R,9R,11R,12R,13S,14R)-7-ethenyl-14-ethyl-3-fluoro-12,13-dihydroxy-7-methoxy-3,5,9,11,13-pentamethyl-oxacyclotetradecane-2,4,10-trione |
| SMILES | C=C[C@]1(OC)CC(C)C(=O)[C@](C)(F)C(=O)O[C@H](CC)[C@@](C)(O)[C@H](O)[C@@H](C)C(=O)[C@H](C)C1 |
| InChI | InChI=1S/C23H37FO7/c1-9-16-22(7,29)19(27)15(5)17(25)13(3)11-23(10-2,30-8)12-14(4)18(26)21(6,24)20(28)31-16/h10,13-16,19,27,29H,2,9,11-12H2,1,3-8H3/t13-,14?,15+,16-,19-,21+,22-,23-/m1/s1 |
| InChIKey | VOZPLFRXPXLGDJ-PEESWTHVSA-N |
| XLogP | 2.56 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|