About ethene;(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine
ethene;(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine (PubChem CID 143418344) has the molecular formula C13H25FN2O
and a molecular weight of 244.35 g/mol. Its IUPAC name is ethene;(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine.
Molecular Properties
| Compound Name | ethene;(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine |
| PubChem CID | 143418344 |
| Molecular Formula | C13H25FN2O |
| Molecular Weight | 244.35 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | ethene;(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine |
| SMILES | C/C=C(\C=C/CCN)C(OC)C(N)CF.C=C |
| InChI | InChI=1S/C11H21FN2O.C2H4/c1-3-9(6-4-5-7-13)11(15-2)10(14)8-12;1-2/h3-4,6,10-11H,5,7-8,13-14H2,1-2H3;1-2H2/b6-4-,9-3+; |
| InChIKey | JRNTYXRGGRHTOH-ANZGCBAVSA-N |
| XLogP | 1.95 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethene;(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine?
The IUPAC name of ethene;(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine (CID 143418344) is ethene;(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine.
What is the SMILES notation for ethene;(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine?
The canonical SMILES for ethene;(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine is C/C=C(\C=C/CCN)C(OC)C(N)CF.C=C.
What is the InChIKey of ethene;(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine?
The InChIKey is JRNTYXRGGRHTOH-ANZGCBAVSA-N. The full InChI is InChI=1S/C11H21FN2O.C2H4/c1-3-9(6-4-5-7-13)11(15-2)10(14)8-12;1-2/h3-4,6,10-11H,5,7-8,13-14H2,1-2H3;1-2H2/b6-4-,9-3+;.
What are the key properties of ethene;(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine?
ethene;(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine has a molecular weight of 244.35 g/mol, XLogP of 1.95, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;(Z,5E)-5-ethylidene-8-fluoro-6-methoxyoct-3-ene-1,7-diamine is sourced from PubChem (CID 143418344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).