About 4-[4-[(1S,2S)-3-fluoro-1-methoxy-2-methylpropyl]phenyl]oxane
4-[4-[(1S,2S)-3-fluoro-1-methoxy-2-methylpropyl]phenyl]oxane (PubChem CID 143418430) has the molecular formula C16H23FO2
and a molecular weight of 266.36 g/mol. Its IUPAC name is 4-[4-[(1S,2S)-3-fluoro-1-methoxy-2-methylpropyl]phenyl]oxane.
Molecular Properties
| Compound Name | 4-[4-[(1S,2S)-3-fluoro-1-methoxy-2-methylpropyl]phenyl]oxane |
| PubChem CID | 143418430 |
| Molecular Formula | C16H23FO2 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 4-[4-[(1S,2S)-3-fluoro-1-methoxy-2-methylpropyl]phenyl]oxane |
| SMILES | CO[C@H](c1ccc(C2CCOCC2)cc1)[C@H](C)CF |
| InChI | InChI=1S/C16H23FO2/c1-12(11-17)16(18-2)15-5-3-13(4-6-15)14-7-9-19-10-8-14/h3-6,12,14,16H,7-11H2,1-2H3/t12-,16+/m1/s1 |
| InChIKey | ZGLSDZIGMIVUMO-WBMJQRKESA-N |
| XLogP | 3.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4-[(1S,2S)-3-fluoro-1-methoxy-2-methylpropyl]phenyl]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(1S,2S)-3-fluoro-1-methoxy-2-methylpropyl]phenyl]oxane?
The IUPAC name of 4-[4-[(1S,2S)-3-fluoro-1-methoxy-2-methylpropyl]phenyl]oxane (CID 143418430) is 4-[4-[(1S,2S)-3-fluoro-1-methoxy-2-methylpropyl]phenyl]oxane.
What is the SMILES notation for 4-[4-[(1S,2S)-3-fluoro-1-methoxy-2-methylpropyl]phenyl]oxane?
The canonical SMILES for 4-[4-[(1S,2S)-3-fluoro-1-methoxy-2-methylpropyl]phenyl]oxane is CO[C@H](c1ccc(C2CCOCC2)cc1)[C@H](C)CF.
What is the InChIKey of 4-[4-[(1S,2S)-3-fluoro-1-methoxy-2-methylpropyl]phenyl]oxane?
The InChIKey is ZGLSDZIGMIVUMO-WBMJQRKESA-N. The full InChI is InChI=1S/C16H23FO2/c1-12(11-17)16(18-2)15-5-3-13(4-6-15)14-7-9-19-10-8-14/h3-6,12,14,16H,7-11H2,1-2H3/t12-,16+/m1/s1.
What are the key properties of 4-[4-[(1S,2S)-3-fluoro-1-methoxy-2-methylpropyl]phenyl]oxane?
4-[4-[(1S,2S)-3-fluoro-1-methoxy-2-methylpropyl]phenyl]oxane has a molecular weight of 266.36 g/mol, XLogP of 3.87, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(1S,2S)-3-fluoro-1-methoxy-2-methylpropyl]phenyl]oxane is sourced from PubChem (CID 143418430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).