About ethane;(Z,4E)-4-ethylidene-1-fluoro-3-methoxy-7-pyrrolidin-1-ylhept-5-en-2-amine
ethane;(Z,4E)-4-ethylidene-1-fluoro-3-methoxy-7-pyrrolidin-1-ylhept-5-en-2-amine (PubChem CID 143418523) has the molecular formula C16H31FN2O
and a molecular weight of 286.44 g/mol. Its IUPAC name is ethane;(Z,4E)-4-ethylidene-1-fluoro-3-methoxy-7-pyrrolidin-1-ylhept-5-en-2-amine.
Molecular Properties
| Compound Name | ethane;(Z,4E)-4-ethylidene-1-fluoro-3-methoxy-7-pyrrolidin-1-ylhept-5-en-2-amine |
| PubChem CID | 143418523 |
| Molecular Formula | C16H31FN2O |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | ethane;(Z,4E)-4-ethylidene-1-fluoro-3-methoxy-7-pyrrolidin-1-ylhept-5-en-2-amine |
| SMILES | C/C=C(\C=C/CN1CCCC1)C(OC)C(N)CF.CC |
| InChI | InChI=1S/C14H25FN2O.C2H6/c1-3-12(14(18-2)13(16)11-15)7-6-10-17-8-4-5-9-17;1-2/h3,6-7,13-14H,4-5,8-11,16H2,1-2H3;1-2H3/b7-6-,12-3+; |
| InChIKey | DZKQIPOQZYIDLE-XCRJLICUSA-N |
| XLogP | 2.92 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z,4E)-4-ethylidene-1-fluoro-3-methoxy-7-pyrrolidin-1-ylhept-5-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z,4E)-4-ethylidene-1-fluoro-3-methoxy-7-pyrrolidin-1-ylhept-5-en-2-amine?
The IUPAC name of ethane;(Z,4E)-4-ethylidene-1-fluoro-3-methoxy-7-pyrrolidin-1-ylhept-5-en-2-amine (CID 143418523) is ethane;(Z,4E)-4-ethylidene-1-fluoro-3-methoxy-7-pyrrolidin-1-ylhept-5-en-2-amine.
What is the SMILES notation for ethane;(Z,4E)-4-ethylidene-1-fluoro-3-methoxy-7-pyrrolidin-1-ylhept-5-en-2-amine?
The canonical SMILES for ethane;(Z,4E)-4-ethylidene-1-fluoro-3-methoxy-7-pyrrolidin-1-ylhept-5-en-2-amine is C/C=C(\C=C/CN1CCCC1)C(OC)C(N)CF.CC.
What is the InChIKey of ethane;(Z,4E)-4-ethylidene-1-fluoro-3-methoxy-7-pyrrolidin-1-ylhept-5-en-2-amine?
The InChIKey is DZKQIPOQZYIDLE-XCRJLICUSA-N. The full InChI is InChI=1S/C14H25FN2O.C2H6/c1-3-12(14(18-2)13(16)11-15)7-6-10-17-8-4-5-9-17;1-2/h3,6-7,13-14H,4-5,8-11,16H2,1-2H3;1-2H3/b7-6-,12-3+;.
What are the key properties of ethane;(Z,4E)-4-ethylidene-1-fluoro-3-methoxy-7-pyrrolidin-1-ylhept-5-en-2-amine?
ethane;(Z,4E)-4-ethylidene-1-fluoro-3-methoxy-7-pyrrolidin-1-ylhept-5-en-2-amine has a molecular weight of 286.44 g/mol, XLogP of 2.92, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z,4E)-4-ethylidene-1-fluoro-3-methoxy-7-pyrrolidin-1-ylhept-5-en-2-amine is sourced from PubChem (CID 143418523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).