C9H11FO2 — CID 143418883
4-fluoro-2,3-dimethoxycyclohepta-1,3,5-triene (PubChem CID 143418883) has the molecular formula C9H11FO2 and a molecular weight of 170.18 g/mol. Its IUPAC name is 4-fluoro-2,3-dimethoxycyclohepta-1,3,5-triene.
| Compound Name | 4-fluoro-2,3-dimethoxycyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 143418883 |
| Molecular Formula | C9H11FO2 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 4-fluoro-2,3-dimethoxycyclohepta-1,3,5-triene |
| SMILES | COC1=CCC=CC(F)=C1OC |
| InChI | InChI=1S/C9H11FO2/c1-11-8-6-4-3-5-7(10)9(8)12-2/h3,5-6H,4H2,1-2H3 |
| InChIKey | JQGCZHGFNGZLDK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |