About 3-chloro-1-[(2Z,4E)-6-chlorohexa-2,4-dien-3-yl]-6-methylidenepyridazine
3-chloro-1-[(2Z,4E)-6-chlorohexa-2,4-dien-3-yl]-6-methylidenepyridazine (PubChem CID 143419130) has the molecular formula C11H12Cl2N2
and a molecular weight of 243.14 g/mol. Its IUPAC name is 3-chloro-1-[(2Z,4E)-6-chlorohexa-2,4-dien-3-yl]-6-methylidenepyridazine.
Molecular Properties
| Compound Name | 3-chloro-1-[(2Z,4E)-6-chlorohexa-2,4-dien-3-yl]-6-methylidenepyridazine |
| PubChem CID | 143419130 |
| Molecular Formula | C11H12Cl2N2 |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 3-chloro-1-[(2Z,4E)-6-chlorohexa-2,4-dien-3-yl]-6-methylidenepyridazine |
| SMILES | C=C1C=CC(Cl)=NN1C(=C\C)/C=C/CCl |
| InChI | InChI=1S/C11H12Cl2N2/c1-3-10(5-4-8-12)15-9(2)6-7-11(13)14-15/h3-7H,2,8H2,1H3/b5-4+,10-3- |
| InChIKey | LWIHHKNSRCUITC-IMXHIACISA-N |
| XLogP | 3.62 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-1-[(2Z,4E)-6-chlorohexa-2,4-dien-3-yl]-6-methylidenepyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1-[(2Z,4E)-6-chlorohexa-2,4-dien-3-yl]-6-methylidenepyridazine?
The IUPAC name of 3-chloro-1-[(2Z,4E)-6-chlorohexa-2,4-dien-3-yl]-6-methylidenepyridazine (CID 143419130) is 3-chloro-1-[(2Z,4E)-6-chlorohexa-2,4-dien-3-yl]-6-methylidenepyridazine.
What is the SMILES notation for 3-chloro-1-[(2Z,4E)-6-chlorohexa-2,4-dien-3-yl]-6-methylidenepyridazine?
The canonical SMILES for 3-chloro-1-[(2Z,4E)-6-chlorohexa-2,4-dien-3-yl]-6-methylidenepyridazine is C=C1C=CC(Cl)=NN1C(=C\C)/C=C/CCl.
What is the InChIKey of 3-chloro-1-[(2Z,4E)-6-chlorohexa-2,4-dien-3-yl]-6-methylidenepyridazine?
The InChIKey is LWIHHKNSRCUITC-IMXHIACISA-N. The full InChI is InChI=1S/C11H12Cl2N2/c1-3-10(5-4-8-12)15-9(2)6-7-11(13)14-15/h3-7H,2,8H2,1H3/b5-4+,10-3-.
What are the key properties of 3-chloro-1-[(2Z,4E)-6-chlorohexa-2,4-dien-3-yl]-6-methylidenepyridazine?
3-chloro-1-[(2Z,4E)-6-chlorohexa-2,4-dien-3-yl]-6-methylidenepyridazine has a molecular weight of 243.14 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1-[(2Z,4E)-6-chlorohexa-2,4-dien-3-yl]-6-methylidenepyridazine is sourced from PubChem (CID 143419130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).