About 3-methyl-6-methylidene-1-[(3Z)-2-methylpenta-1,3-dien-3-yl]pyridazine
3-methyl-6-methylidene-1-[(3Z)-2-methylpenta-1,3-dien-3-yl]pyridazine (PubChem CID 143419229) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-methyl-6-methylidene-1-[(3Z)-2-methylpenta-1,3-dien-3-yl]pyridazine.
Molecular Properties
| Compound Name | 3-methyl-6-methylidene-1-[(3Z)-2-methylpenta-1,3-dien-3-yl]pyridazine |
| PubChem CID | 143419229 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3-methyl-6-methylidene-1-[(3Z)-2-methylpenta-1,3-dien-3-yl]pyridazine |
| SMILES | C=C(C)/C(=C/C)N1N=C(C)C=CC1=C |
| InChI | InChI=1S/C12H16N2/c1-6-12(9(2)3)14-11(5)8-7-10(4)13-14/h6-8H,2,5H2,1,3-4H3/b12-6- |
| InChIKey | XQIWIVFDVMMZIW-SDQBBNPISA-N |
| XLogP | 3.23 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-6-methylidene-1-[(3Z)-2-methylpenta-1,3-dien-3-yl]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-methylidene-1-[(3Z)-2-methylpenta-1,3-dien-3-yl]pyridazine?
The IUPAC name of 3-methyl-6-methylidene-1-[(3Z)-2-methylpenta-1,3-dien-3-yl]pyridazine (CID 143419229) is 3-methyl-6-methylidene-1-[(3Z)-2-methylpenta-1,3-dien-3-yl]pyridazine.
What is the SMILES notation for 3-methyl-6-methylidene-1-[(3Z)-2-methylpenta-1,3-dien-3-yl]pyridazine?
The canonical SMILES for 3-methyl-6-methylidene-1-[(3Z)-2-methylpenta-1,3-dien-3-yl]pyridazine is C=C(C)/C(=C/C)N1N=C(C)C=CC1=C.
What is the InChIKey of 3-methyl-6-methylidene-1-[(3Z)-2-methylpenta-1,3-dien-3-yl]pyridazine?
The InChIKey is XQIWIVFDVMMZIW-SDQBBNPISA-N. The full InChI is InChI=1S/C12H16N2/c1-6-12(9(2)3)14-11(5)8-7-10(4)13-14/h6-8H,2,5H2,1,3-4H3/b12-6-.
What are the key properties of 3-methyl-6-methylidene-1-[(3Z)-2-methylpenta-1,3-dien-3-yl]pyridazine?
3-methyl-6-methylidene-1-[(3Z)-2-methylpenta-1,3-dien-3-yl]pyridazine has a molecular weight of 188.27 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-methylidene-1-[(3Z)-2-methylpenta-1,3-dien-3-yl]pyridazine is sourced from PubChem (CID 143419229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).