About methoxy-[[N'-methyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]azanium
methoxy-[[N'-methyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]azanium (PubChem CID 143419428) has the molecular formula C8H19N4O2+
and a molecular weight of 203.27 g/mol. Its IUPAC name is methoxy-[[N'-methyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]azanium.
Molecular Properties
| Compound Name | methoxy-[[N'-methyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]azanium |
| PubChem CID | 143419428 |
| Molecular Formula | C8H19N4O2+ |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | methoxy-[[N'-methyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]azanium |
| SMILES | C/N=C(/NCC1CCOC1)N[NH2+]OC |
| InChI | InChI=1S/C8H18N4O2/c1-9-8(11-12-13-2)10-5-7-3-4-14-6-7/h7,12H,3-6H2,1-2H3,(H2,9,10,11)/p+1 |
| InChIKey | XGHUJGPKGOLOOJ-UHFFFAOYSA-O |
| XLogP | -1.77 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methoxy-[[N'-methyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxy-[[N'-methyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]azanium?
The IUPAC name of methoxy-[[N'-methyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]azanium (CID 143419428) is methoxy-[[N'-methyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]azanium.
What is the SMILES notation for methoxy-[[N'-methyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]azanium?
The canonical SMILES for methoxy-[[N'-methyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]azanium is C/N=C(/NCC1CCOC1)N[NH2+]OC.
What is the InChIKey of methoxy-[[N'-methyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]azanium?
The InChIKey is XGHUJGPKGOLOOJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H18N4O2/c1-9-8(11-12-13-2)10-5-7-3-4-14-6-7/h7,12H,3-6H2,1-2H3,(H2,9,10,11)/p+1.
What are the key properties of methoxy-[[N'-methyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]azanium?
methoxy-[[N'-methyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]azanium has a molecular weight of 203.27 g/mol, XLogP of -1.77, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy-[[N'-methyl-N-(oxolan-3-ylmethyl)carbamimidoyl]amino]azanium is sourced from PubChem (CID 143419428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).