C26H34O5 — CID 143419672
ethyl (17R)-3-methoxy-10,13-dimethyl-2'-oxospiro[1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-3'-carboxylate (PubChem CID 143419672) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is ethyl (17R)-3-methoxy-10,13-dimethyl-2'-oxospiro[1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-3'-carboxylate.
| Compound Name | ethyl (17R)-3-methoxy-10,13-dimethyl-2'-oxospiro[1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-3'-carboxylate |
|---|---|
| PubChem CID | 143419672 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | ethyl (17R)-3-methoxy-10,13-dimethyl-2'-oxospiro[1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-3'-carboxylate |
| SMILES | CCOC(=O)C1C[C@@]2(CCC3C4CC=C5C=C(OC)CCC5(C)C4=CCC32C)OC1=O |
| InChI | InChI=1S/C26H34O5/c1-5-30-22(27)19-15-26(31-23(19)28)13-10-21-18-7-6-16-14-17(29-4)8-11-24(16,2)20(18)9-12-25(21,26)3/h6,9,14,18-19,21H,5,7-8,10-13,15H2,1-4H3/t18?,19?,21?,24?,25?,26-/m1/s1 |
| InChIKey | FXVXDBAIBSWEOY-YSUGVLJNSA-N |
| XLogP | 4.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|