C14H18O3 — CID 143419762
ethyl (1S)-5-ethynyl-1,6,6-trimethyl-2-oxobicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 143419762) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is ethyl (1S)-5-ethynyl-1,6,6-trimethyl-2-oxobicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | ethyl (1S)-5-ethynyl-1,6,6-trimethyl-2-oxobicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 143419762 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | ethyl (1S)-5-ethynyl-1,6,6-trimethyl-2-oxobicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | C#CC12CC(C(=O)OCC)C(=O)[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C14H18O3/c1-6-14-8-9(11(16)17-7-2)10(15)13(14,5)12(14,3)4/h1,9H,7-8H2,2-5H3/t9?,13-,14?/m0/s1 |
| InChIKey | OMNBORFGCRBQAP-IMXVTNBVSA-N |
| XLogP | 1.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|