C24H19N2+ — CID 143420430
N,N-diphenyl-9H-carbazol-9-ium-3-amine (PubChem CID 143420430) has the molecular formula C24H19N2+ and a molecular weight of 335.43 g/mol. Its IUPAC name is N,N-diphenyl-9H-carbazol-9-ium-3-amine.
| Compound Name | N,N-diphenyl-9H-carbazol-9-ium-3-amine |
|---|---|
| PubChem CID | 143420430 |
| Molecular Formula | C24H19N2+ |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N,N-diphenyl-9H-carbazol-9-ium-3-amine |
| SMILES | c1ccc(N(c2ccccc2)c2ccc3c(c2)-c2ccccc2[NH2+]3)cc1 |
| InChI | InChI=1S/C24H18N2/c1-3-9-18(10-4-1)26(19-11-5-2-6-12-19)20-15-16-24-22(17-20)21-13-7-8-14-23(21)25-24/h1-17,25H/p+1 |
| InChIKey | YBGHXHSQISJNDM-UHFFFAOYSA-O |
| XLogP | 5.66 |
| TPSA | 19.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|