About (E)-2-fluoro-N,3-dimethylpent-2-en-1-imine
(E)-2-fluoro-N,3-dimethylpent-2-en-1-imine (PubChem CID 143420584) has the molecular formula C7H12FN
and a molecular weight of 129.18 g/mol. Its IUPAC name is (E)-2-fluoro-N,3-dimethylpent-2-en-1-imine.
Molecular Properties
| Compound Name | (E)-2-fluoro-N,3-dimethylpent-2-en-1-imine |
| PubChem CID | 143420584 |
| Molecular Formula | C7H12FN |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | (E)-2-fluoro-N,3-dimethylpent-2-en-1-imine |
| SMILES | CC/C(C)=C(F)\C=N\C |
| InChI | InChI=1S/C7H12FN/c1-4-6(2)7(8)5-9-3/h5H,4H2,1-3H3/b7-6+,9-5+ |
| InChIKey | ROEZNDRJOGRFKO-CQCRHSALSA-N |
| XLogP | 2.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-fluoro-N,3-dimethylpent-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-fluoro-N,3-dimethylpent-2-en-1-imine?
The IUPAC name of (E)-2-fluoro-N,3-dimethylpent-2-en-1-imine (CID 143420584) is (E)-2-fluoro-N,3-dimethylpent-2-en-1-imine.
What is the SMILES notation for (E)-2-fluoro-N,3-dimethylpent-2-en-1-imine?
The canonical SMILES for (E)-2-fluoro-N,3-dimethylpent-2-en-1-imine is CC/C(C)=C(F)\C=N\C.
What is the InChIKey of (E)-2-fluoro-N,3-dimethylpent-2-en-1-imine?
The InChIKey is ROEZNDRJOGRFKO-CQCRHSALSA-N. The full InChI is InChI=1S/C7H12FN/c1-4-6(2)7(8)5-9-3/h5H,4H2,1-3H3/b7-6+,9-5+.
What are the key properties of (E)-2-fluoro-N,3-dimethylpent-2-en-1-imine?
(E)-2-fluoro-N,3-dimethylpent-2-en-1-imine has a molecular weight of 129.18 g/mol, XLogP of 2.34, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-fluoro-N,3-dimethylpent-2-en-1-imine is sourced from PubChem (CID 143420584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).