C24H25BCl2N4O5S — CID 143421038
(5R)-7-(3,5-dichlorophenyl)-5-methyl-6-oxo-5-[[4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]imidazo[1,2-a]imidazole-3-sulfonamide (PubChem CID 143421038) has the molecular formula C24H25BCl2N4O5S and a molecular weight of 563.27 g/mol. Its IUPAC name is (5R)-7-(3,5-dichlorophenyl)-5-methyl-6-oxo-5-[[4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]imidazo[1,2-a]imidazole-3-sulfonamide.
| Compound Name | (5R)-7-(3,5-dichlorophenyl)-5-methyl-6-oxo-5-[[4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]imidazo[1,2-a]imidazole-3-sulfonamide |
|---|---|
| PubChem CID | 143421038 |
| Molecular Formula | C24H25BCl2N4O5S |
| Molecular Weight | 563.27 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | (5R)-7-(3,5-dichlorophenyl)-5-methyl-6-oxo-5-[[4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]imidazo[1,2-a]imidazole-3-sulfonamide |
| SMILES | CC1OB(c2ccc(C[C@]3(C)C(=O)N(c4cc(Cl)cc(Cl)c4)c4ncc(S(N)(=O)=O)n43)cc2)OC1(C)C |
| InChI | InChI=1S/C24H25BCl2N4O5S/c1-14-23(2,3)36-25(35-14)16-7-5-15(6-8-16)12-24(4)21(32)30(19-10-17(26)9-18(27)11-19)22-29-13-20(31(22)24)37(28,33)34/h5-11,13-14H,12H2,1-4H3,(H2,28,33,34)/t14?,24-/m1/s1 |
| InChIKey | MANDJASBZDBFMK-PYFQUHSISA-N |
| XLogP | 3.38 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|