C24H19F6N5O3 — CID 143422313
N-methyl-2-nitro-4-[[2-[4-phenyl-5-(trifluoromethyl)-1H-imidazol-2-yl]-4-pyridinyl]oxy]aniline;1,1,1-trifluoroethane (PubChem CID 143422313) has the molecular formula C24H19F6N5O3 and a molecular weight of 539.44 g/mol. Its IUPAC name is N-methyl-2-nitro-4-[[2-[4-phenyl-5-(trifluoromethyl)-1H-imidazol-2-yl]-4-pyridinyl]oxy]aniline;1,1,1-trifluoroethane.
| Compound Name | N-methyl-2-nitro-4-[[2-[4-phenyl-5-(trifluoromethyl)-1H-imidazol-2-yl]-4-pyridinyl]oxy]aniline;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 143422313 |
| Molecular Formula | C24H19F6N5O3 |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | N-methyl-2-nitro-4-[[2-[4-phenyl-5-(trifluoromethyl)-1H-imidazol-2-yl]-4-pyridinyl]oxy]aniline;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.CNc1ccc(Oc2ccnc(-c3nc(-c4ccccc4)c(C(F)(F)F)[nH]3)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H16F3N5O3.C2H3F3/c1-26-16-8-7-14(12-18(16)30(31)32)33-15-9-10-27-17(11-15)21-28-19(13-5-3-2-4-6-13)20(29-21)22(23,24)25;1-2(3,4)5/h2-12,26H,1H3,(H,28,29);1H3 |
| InChIKey | PQHAPVAYWUYDNM-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|