C28H43N7 — CID 143422412
N-[3-[(dimethylamino)methyl]-2-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-7H-imidazo[1,2-a]azepin-5-yl]-N'-ethyl-N'-methylpropane-1,3-diamine (PubChem CID 143422412) has the molecular formula C28H43N7 and a molecular weight of 477.70 g/mol. Its IUPAC name is N-[3-[(dimethylamino)methyl]-2-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-7H-imidazo[1,2-a]azepin-5-yl]-N'-ethyl-N'-methylpropane-1,3-diamine.
| Compound Name | N-[3-[(dimethylamino)methyl]-2-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-7H-imidazo[1,2-a]azepin-5-yl]-N'-ethyl-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 143422412 |
| Molecular Formula | C28H43N7 |
| Molecular Weight | 477.70 g/mol |
| Exact Mass | 477.36 |
| IUPAC Name | N-[3-[(dimethylamino)methyl]-2-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-7H-imidazo[1,2-a]azepin-5-yl]-N'-ethyl-N'-methylpropane-1,3-diamine |
| SMILES | CCN(C)CCCNC1=CCC=Cc2nc(CN(C)[C@H]3CCCc4cccnc43)c(CN(C)C)n21 |
| InChI | InChI=1S/C28H43N7/c1-6-33(4)19-11-18-29-26-15-7-8-16-27-31-23(25(35(26)27)21-32(2)3)20-34(5)24-14-9-12-22-13-10-17-30-28(22)24/h8,10,13,15-17,24,29H,6-7,9,11-12,14,18-21H2,1-5H3/t24-/m0/s1 |
| InChIKey | UQUOBNDCZUFFKZ-DEOSSOPVSA-N |
| XLogP | 4.00 |
| TPSA | 52.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.70 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|