C16H19NO2S — CID 143423024
(3E)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dienoic acid (PubChem CID 143423024) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is (3E)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dienoic acid.
| Compound Name | (3E)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 143423024 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | (3E)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dienoic acid |
| SMILES | C=C/C=C(\C=C/C)C(C(=O)O)N1CCc2sccc2C1 |
| InChI | InChI=1S/C16H19NO2S/c1-3-5-12(6-4-2)15(16(18)19)17-9-7-14-13(11-17)8-10-20-14/h3-6,8,10,15H,1,7,9,11H2,2H3,(H,18,19)/b6-4-,12-5+ |
| InChIKey | HBNICFHAKCWVDN-GLNLJRCCSA-N |
| XLogP | 3.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|