C20H33NS — CID 143423057
4-(3,3-dimethylpent-1-en-2-ylsulfanyl)-N,5,6-trimethyl-3,4,5,6-tetrahydro-2H-naphthalen-4a-amine (PubChem CID 143423057) has the molecular formula C20H33NS and a molecular weight of 319.56 g/mol. Its IUPAC name is 4-(3,3-dimethylpent-1-en-2-ylsulfanyl)-N,5,6-trimethyl-3,4,5,6-tetrahydro-2H-naphthalen-4a-amine.
| Compound Name | 4-(3,3-dimethylpent-1-en-2-ylsulfanyl)-N,5,6-trimethyl-3,4,5,6-tetrahydro-2H-naphthalen-4a-amine |
|---|---|
| PubChem CID | 143423057 |
| Molecular Formula | C20H33NS |
| Molecular Weight | 319.56 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 4-(3,3-dimethylpent-1-en-2-ylsulfanyl)-N,5,6-trimethyl-3,4,5,6-tetrahydro-2H-naphthalen-4a-amine |
| SMILES | C=C(SC1CCC=C2C=CC(C)C(C)C21NC)C(C)(C)CC |
| InChI | InChI=1S/C20H33NS/c1-8-19(5,6)16(4)22-18-11-9-10-17-13-12-14(2)15(3)20(17,18)21-7/h10,12-15,18,21H,4,8-9,11H2,1-3,5-7H3 |
| InChIKey | MENAEPXGZUNBPL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |